WARNING: This product is for research use only, not for human or veterinary use.
MedKoo CAT#: 555619
CAS#: 135330-08-4
Description: RP-54745 is an Inhibitor of macrophage stimulation and interleukin-1 production. RP 54745 might influence certain cells and cytokines implicated in the regulation of the immune system, the disfunctioning of which can lead to inflammatory disorders or autoimmune pathologies. RP-54745 is a very attractive antirheumatic compound and a potentially effective treatment in pathologies where IL-1 production is exacerbated.
MedKoo Cat#: 555619
Name: RP-54745
CAS#: 135330-08-4
Chemical Formula: C13H12ClNOS2
Exact Mass: 297.0049
Molecular Weight: 297.815
Elemental Analysis: C, 52.43; H, 4.06; Cl, 11.90; N, 4.70; O, 5.37; S, 21.53
Synonym: RP-54745; RP 54745; RP54745;
IUPAC/Chemical Name: 4-Chloro-5-(3,4-dihydro-1-methyl-2(1H)-isoquinolinyl)-3H-1,2-dithiol-3-one
InChi Key: BEJJGVDFQORITE-UHFFFAOYSA-N
InChi Code: InChI=1S/C13H12ClNOS2/c1-8-10-5-3-2-4-9(10)6-7-15(8)12-11(14)13(16)18-17-12/h2-5,8H,6-7H2,1H3
SMILES Code: O=C1SSC(N2C(C)C3=C(C=CC=C3)CC2)=C1Cl
1: Folliard F, Bousseau A, Terlain B. RP 54745, a potential antirheumatic
compound. II. In vivo properties in different animal models. Agents Actions. 1992
May;36(1-2):127-35. PubMed PMID: 1414681.
2: Folliard F, Bousseau A, Terlain B. RP 54745, a potential antirheumatic
compound. I. Inhibitor of macrophage stimulation and interleukin-1 production.
Agents Actions. 1992 May;36(1-2):119-26. PubMed PMID: 1414680.